C15H22O6 — CID 100963906
(1R,6S,7S,8S,10R,11S,13R)-7,8,11-trihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one (PubChem CID 100963906) has the molecular formula C15H22O6 and a molecular weight of 298.33 g/mol. Its IUPAC name is (1R,6S,7S,8S,10R,11S,13R)-7,8,11-trihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one.
| Compound Name | (1R,6S,7S,8S,10R,11S,13R)-7,8,11-trihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one |
|---|---|
| PubChem CID | 100963906 |
| Molecular Formula | C15H22O6 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | (1R,6S,7S,8S,10R,11S,13R)-7,8,11-trihydroxy-6,7,13-trimethyl-4,9-dioxatetracyclo[6.5.1.01,10.06,10]tetradecan-3-one |
| SMILES | C[C@@H]1C[C@H](O)[C@@]23O[C@@]4(O)C[C@@]12CC(=O)OC[C@@]3(C)[C@]4(C)O |
| InChI | InChI=1S/C15H22O6/c1-8-4-9(16)15-11(2)7-20-10(17)5-13(8,15)6-14(19,21-15)12(11,3)18/h8-9,16,18-19H,4-7H2,1-3H3/t8-,9+,11+,12+,13+,14+,15+/m1/s1 |
| InChIKey | LNAKLMRMQNPPRW-CHYPQVGFSA-N |
| XLogP | -0.06 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |