C15H22O4 — CID 5459247
(1R,2R,6S)-5-hydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione (PubChem CID 5459247) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is (1R,2R,6S)-5-hydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione.
| Compound Name | (1R,2R,6S)-5-hydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione |
|---|---|
| PubChem CID | 5459247 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | (1R,2R,6S)-5-hydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione |
| SMILES | CC1C(=O)C[C@]23CC(=O)OC[C@@]1(C)C2(O)CC[C@H]3C |
| InChI | InChI=1S/C15H22O4/c1-9-4-5-15(18)13(3)8-19-12(17)7-14(9,15)6-11(16)10(13)2/h9-10,18H,4-8H2,1-3H3/t9-,10?,13-,14-,15?/m1/s1 |
| InChIKey | JPVXKJWKUYJFIJ-OHZUZTNLSA-N |
| XLogP | 1.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |