C15H22O5 — CID 101111337
(1S,2R,5S,6S,9R,10S,13R)-5,9,13-trihydroxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridecan-11-one (PubChem CID 101111337) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (1S,2R,5S,6S,9R,10S,13R)-5,9,13-trihydroxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridecan-11-one.
| Compound Name | (1S,2R,5S,6S,9R,10S,13R)-5,9,13-trihydroxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridecan-11-one |
|---|---|
| PubChem CID | 101111337 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (1S,2R,5S,6S,9R,10S,13R)-5,9,13-trihydroxy-2,6,10-trimethyl-8-oxatetracyclo[7.3.1.01,5.06,10]tridecan-11-one |
| SMILES | C[C@@H]1CC[C@@]2(O)[C@@]13CC(=O)[C@]1(C)[C@@]2(C)CO[C@@]1(O)[C@@H]3O |
| InChI | InChI=1S/C15H22O5/c1-8-4-5-14(18)11(2)7-20-15(19)10(17)13(8,14)6-9(16)12(11,15)3/h8,10,17-19H,4-7H2,1-3H3/t8-,10-,11-,12-,13+,14+,15+/m1/s1 |
| InChIKey | VYQVVSPAPSKYFT-PJYOXCPESA-N |
| XLogP | 0.21 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |