C15H20O6 — CID 101021290
(1S,4R,5S,9R,11R,13S,14S)-4,13-dihydroxy-4,5,14-trimethyl-7,10-dioxatetracyclo[9.2.1.01,9.05,13]tetradecane-3,8-dione (PubChem CID 101021290) has the molecular formula C15H20O6 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1S,4R,5S,9R,11R,13S,14S)-4,13-dihydroxy-4,5,14-trimethyl-7,10-dioxatetracyclo[9.2.1.01,9.05,13]tetradecane-3,8-dione.
| Compound Name | (1S,4R,5S,9R,11R,13S,14S)-4,13-dihydroxy-4,5,14-trimethyl-7,10-dioxatetracyclo[9.2.1.01,9.05,13]tetradecane-3,8-dione |
|---|---|
| PubChem CID | 101021290 |
| Molecular Formula | C15H20O6 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (1S,4R,5S,9R,11R,13S,14S)-4,13-dihydroxy-4,5,14-trimethyl-7,10-dioxatetracyclo[9.2.1.01,9.05,13]tetradecane-3,8-dione |
| SMILES | C[C@@H]1[C@H]2C[C@]3(O)[C@@]14CC(=O)[C@](C)(O)[C@@]3(C)COC(=O)[C@@H]4O2 |
| InChI | InChI=1S/C15H20O6/c1-7-8-4-15(19)12(2)6-20-11(17)10(21-8)14(7,15)5-9(16)13(12,3)18/h7-8,10,18-19H,4-6H2,1-3H3/t7-,8-,10+,12-,13+,14+,15-/m1/s1 |
| InChIKey | HHHKOJDWCXXGIP-XFNGARLGSA-N |
| XLogP | -0.20 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |