C22H28O7 — CID 102166404
[(1R,2R,4S,5R,6R,7R,8R)-4,5,7-trihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl benzoate (PubChem CID 102166404) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6R,7R,8R)-4,5,7-trihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl benzoate.
| Compound Name | [(1R,2R,4S,5R,6R,7R,8R)-4,5,7-trihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl benzoate |
|---|---|
| PubChem CID | 102166404 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(1R,2R,4S,5R,6R,7R,8R)-4,5,7-trihydroxy-2,6,7-trimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl benzoate |
| SMILES | C[C@@H]1C[C@H](O)[C@@]2(O)[C@]13CC(=O)O[C@H](C3)[C@](C)(O)[C@@]2(C)COC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H28O7/c1-13-9-15(23)22(27)19(2,12-28-18(25)14-7-5-4-6-8-14)20(3,26)16-10-21(13,22)11-17(24)29-16/h4-8,13,15-16,23,26-27H,9-12H2,1-3H3/t13-,15+,16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | ZITRFNIWSSHOFM-NIDZGDMWSA-N |
| XLogP | 1.44 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |