C24H27NO7 — CID 102450421
[(4S,5S,7R,8R,9R)-7,8,9-trihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl benzoate (PubChem CID 102450421) has the molecular formula C24H27NO7 and a molecular weight of 441.48 g/mol. Its IUPAC name is [(4S,5S,7R,8R,9R)-7,8,9-trihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl benzoate.
| Compound Name | [(4S,5S,7R,8R,9R)-7,8,9-trihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl benzoate |
|---|---|
| PubChem CID | 102450421 |
| Molecular Formula | C24H27NO7 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | [(4S,5S,7R,8R,9R)-7,8,9-trihydroxy-2-(4-methoxyphenyl)-4,9-dimethyl-3-oxa-1-azaspiro[4.4]non-1-en-8-yl]methyl benzoate |
| SMILES | COc1ccc(C2=N[C@@]3(C[C@@H](O)[C@](O)(COC(=O)c4ccccc4)[C@]3(C)O)[C@H](C)O2)cc1 |
| InChI | InChI=1S/C24H27NO7/c1-15-23(25-20(32-15)16-9-11-18(30-3)12-10-16)13-19(26)24(29,22(23,2)28)14-31-21(27)17-7-5-4-6-8-17/h4-12,15,19,26,28-29H,13-14H2,1-3H3/t15-,19+,22+,23-,24+/m0/s1 |
| InChIKey | OXDVUTFGQVXECT-DAEBVZRWSA-N |
| XLogP | 1.70 |
| TPSA | 117.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |