C21H20O6 — CID 25053468
[(4E)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylidene]-5-oxooxolan-2-yl]methyl benzoate (PubChem CID 25053468) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is [(4E)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylidene]-5-oxooxolan-2-yl]methyl benzoate.
| Compound Name | [(4E)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylidene]-5-oxooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 25053468 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | [(4E)-2-(hydroxymethyl)-4-[(4-methoxyphenyl)methylidene]-5-oxooxolan-2-yl]methyl benzoate |
| SMILES | COc1ccc(/C=C2\CC(CO)(COC(=O)c3ccccc3)OC2=O)cc1 |
| InChI | InChI=1S/C21H20O6/c1-25-18-9-7-15(8-10-18)11-17-12-21(13-22,27-20(17)24)14-26-19(23)16-5-3-2-4-6-16/h2-11,22H,12-14H2,1H3/b17-11+ |
| InChIKey | JGUCWMOFEHLOIZ-GZTJUZNOSA-N |
| XLogP | 2.61 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|