C21H28O5 — CID 25052839
[(4E)-4-(2-ethylhexylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl benzoate (PubChem CID 25052839) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(4E)-4-(2-ethylhexylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl benzoate.
| Compound Name | [(4E)-4-(2-ethylhexylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 25052839 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(4E)-4-(2-ethylhexylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl benzoate |
| SMILES | CCCCC(/C=C1\CC(CO)(COC(=O)c2ccccc2)OC1=O)CC |
| InChI | InChI=1S/C21H28O5/c1-3-5-9-16(4-2)12-18-13-21(14-22,26-20(18)24)15-25-19(23)17-10-7-6-8-11-17/h6-8,10-12,16,22H,3-5,9,13-15H2,1-2H3/b18-12+ |
| InChIKey | FHHQZFCFVOYPNH-LDADJPATSA-N |
| XLogP | 3.66 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|