C23H40O5 — CID 11795064
[(4Z)-2-(hydroxymethyl)-4-(4-methyl-3-propan-2-ylpentylidene)-5-oxooxolan-2-yl]methyl octanoate (PubChem CID 11795064) has the molecular formula C23H40O5 and a molecular weight of 396.57 g/mol. Its IUPAC name is [(4Z)-2-(hydroxymethyl)-4-(4-methyl-3-propan-2-ylpentylidene)-5-oxooxolan-2-yl]methyl octanoate.
| Compound Name | [(4Z)-2-(hydroxymethyl)-4-(4-methyl-3-propan-2-ylpentylidene)-5-oxooxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 11795064 |
| Molecular Formula | C23H40O5 |
| Molecular Weight | 396.57 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | [(4Z)-2-(hydroxymethyl)-4-(4-methyl-3-propan-2-ylpentylidene)-5-oxooxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1(CO)C/C(=C/CC(C(C)C)C(C)C)C(=O)O1 |
| InChI | InChI=1S/C23H40O5/c1-6-7-8-9-10-11-21(25)27-16-23(15-24)14-19(22(26)28-23)12-13-20(17(2)3)18(4)5/h12,17-18,20,24H,6-11,13-16H2,1-5H3/b19-12- |
| InChIKey | ZWSGCDVERATBCU-UNOMPAQXSA-N |
| XLogP | 4.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|