C12H20O4 — CID 10537322
(3Z)-3-hexylidene-5,5-bis(hydroxymethyl)oxolan-2-one (PubChem CID 10537322) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is (3Z)-3-hexylidene-5,5-bis(hydroxymethyl)oxolan-2-one.
| Compound Name | (3Z)-3-hexylidene-5,5-bis(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 10537322 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (3Z)-3-hexylidene-5,5-bis(hydroxymethyl)oxolan-2-one |
| SMILES | CCCCC/C=C1/CC(CO)(CO)OC1=O |
| InChI | InChI=1S/C12H20O4/c1-2-3-4-5-6-10-7-12(8-13,9-14)16-11(10)15/h6,13-14H,2-5,7-9H2,1H3/b10-6- |
| InChIKey | HOFQMLOAFHHNPR-POHAHGRESA-N |
| XLogP | 1.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|