C28H44O5 — CID 10718802
(3E,5S)-5-(hydroxymethyl)-3-[(Z)-octadec-9-enylidene]-5-[(E)-(2-oxooxolan-3-ylidene)methyl]oxolan-2-one (PubChem CID 10718802) has the molecular formula C28H44O5 and a molecular weight of 460.66 g/mol. Its IUPAC name is (3E,5S)-5-(hydroxymethyl)-3-[(Z)-octadec-9-enylidene]-5-[(E)-(2-oxooxolan-3-ylidene)methyl]oxolan-2-one.
| Compound Name | (3E,5S)-5-(hydroxymethyl)-3-[(Z)-octadec-9-enylidene]-5-[(E)-(2-oxooxolan-3-ylidene)methyl]oxolan-2-one |
|---|---|
| PubChem CID | 10718802 |
| Molecular Formula | C28H44O5 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.32 |
| IUPAC Name | (3E,5S)-5-(hydroxymethyl)-3-[(Z)-octadec-9-enylidene]-5-[(E)-(2-oxooxolan-3-ylidene)methyl]oxolan-2-one |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C=C1\C[C@](/C=C2\CCOC2=O)(CO)OC1=O |
| InChI | InChI=1S/C28H44O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-21-28(23-29,33-27(24)31)22-25-19-20-32-26(25)30/h9-10,18,22,29H,2-8,11-17,19-21,23H2,1H3/b10-9-,24-18+,25-22+/t28-/m0/s1 |
| InChIKey | BUPJTRCQJZCMHE-VGRIZRBTSA-N |
| XLogP | 6.50 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|