C33H50O5 — CID 10792237
[(2R,4Z)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate (PubChem CID 10792237) has the molecular formula C33H50O5 and a molecular weight of 526.76 g/mol. Its IUPAC name is [(2R,4Z)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate.
| Compound Name | [(2R,4Z)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10792237 |
| Molecular Formula | C33H50O5 |
| Molecular Weight | 526.76 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | [(2R,4Z)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl acetate |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C=C1/C[C@@](COCc2ccccc2)(COC(C)=O)OC1=O |
| InChI | InChI=1S/C33H50O5/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21-24-31-25-33(38-32(31)35,28-37-29(2)34)27-36-26-30-22-19-18-20-23-30/h10-11,18-20,22-24H,3-9,12-17,21,25-28H2,1-2H3/b11-10-,31-24-/t33-/m1/s1 |
| InChIKey | IHXBUWAFRVUKKC-AXNJXDQUSA-N |
| XLogP | 8.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.76 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|