C21H30O5 — CID 155395352
[5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl octanoate (PubChem CID 155395352) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl octanoate.
| Compound Name | [5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl octanoate |
|---|---|
| PubChem CID | 155395352 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [5-oxo-2-(phenylmethoxymethyl)oxolan-2-yl]methyl octanoate |
| SMILES | CCCCCCCC(=O)OCC1(COCc2ccccc2)CCC(=O)O1 |
| InChI | InChI=1S/C21H30O5/c1-2-3-4-5-9-12-19(22)25-17-21(14-13-20(23)26-21)16-24-15-18-10-7-6-8-11-18/h6-8,10-11H,2-5,9,12-17H2,1H3 |
| InChIKey | LTJGMWRUVRANMQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|