C18H24O5 — CID 155395483
5-[(1-hydroxy-2-methylbut-3-enoxy)methyl]-5-(phenylmethoxymethyl)oxolan-2-one (PubChem CID 155395483) has the molecular formula C18H24O5 and a molecular weight of 320.39 g/mol. Its IUPAC name is 5-[(1-hydroxy-2-methylbut-3-enoxy)methyl]-5-(phenylmethoxymethyl)oxolan-2-one.
| Compound Name | 5-[(1-hydroxy-2-methylbut-3-enoxy)methyl]-5-(phenylmethoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 155395483 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 5-[(1-hydroxy-2-methylbut-3-enoxy)methyl]-5-(phenylmethoxymethyl)oxolan-2-one |
| SMILES | C=CC(C)C(O)OCC1(COCc2ccccc2)CCC(=O)O1 |
| InChI | InChI=1S/C18H24O5/c1-3-14(2)17(20)22-13-18(10-9-16(19)23-18)12-21-11-15-7-5-4-6-8-15/h3-8,14,17,20H,1,9-13H2,2H3 |
| InChIKey | STJZDWJWEJKLTA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|