C24H37NO4 — CID 11047739
(3E)-5-[(hydroxyamino)methyl]-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)oxolan-2-one (PubChem CID 11047739) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is (3E)-5-[(hydroxyamino)methyl]-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)oxolan-2-one.
| Compound Name | (3E)-5-[(hydroxyamino)methyl]-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11047739 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | (3E)-5-[(hydroxyamino)methyl]-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)oxolan-2-one |
| SMILES | CC(C)CC(C/C=C1\CC(CNO)(COCc2ccccc2)OC1=O)CC(C)C |
| InChI | InChI=1S/C24H37NO4/c1-18(2)12-21(13-19(3)4)10-11-22-14-24(16-25-27,29-23(22)26)17-28-15-20-8-6-5-7-9-20/h5-9,11,18-19,21,25,27H,10,12-17H2,1-4H3/b22-11+ |
| InChIKey | KWGDIRVVVZGSOQ-SSDVNMTOSA-N |
| XLogP | 4.89 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|