C28H42O6 — CID 154693954
[(4E)-2-(hydroxymethyl)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 4-(4-methylphenoxy)butanoate (PubChem CID 154693954) has the molecular formula C28H42O6 and a molecular weight of 474.64 g/mol. Its IUPAC name is [(4E)-2-(hydroxymethyl)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 4-(4-methylphenoxy)butanoate.
| Compound Name | [(4E)-2-(hydroxymethyl)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 4-(4-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 154693954 |
| Molecular Formula | C28H42O6 |
| Molecular Weight | 474.64 g/mol |
| Exact Mass | 474.30 |
| IUPAC Name | [(4E)-2-(hydroxymethyl)-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl 4-(4-methylphenoxy)butanoate |
| SMILES | Cc1ccc(OCCCC(=O)OCC2(CO)C/C(=C\CC(CC(C)C)CC(C)C)C(=O)O2)cc1 |
| InChI | InChI=1S/C28H42O6/c1-20(2)15-23(16-21(3)4)10-11-24-17-28(18-29,34-27(24)31)19-33-26(30)7-6-14-32-25-12-8-22(5)9-13-25/h8-9,11-13,20-21,23,29H,6-7,10,14-19H2,1-5H3/b24-11+ |
| InChIKey | XIYJGDFLLIYAJD-BHGWPJFGSA-N |
| XLogP | 5.40 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|