C32H38O6 — CID 154693977
[(4E)-2-(hydroxymethyl)-4-(5-methylhexylidene)-5-oxooxolan-2-yl]methyl 4-[4-[2-(4-methylphenyl)ethynyl]phenoxy]butanoate (PubChem CID 154693977) has the molecular formula C32H38O6 and a molecular weight of 518.65 g/mol. Its IUPAC name is [(4E)-2-(hydroxymethyl)-4-(5-methylhexylidene)-5-oxooxolan-2-yl]methyl 4-[4-[2-(4-methylphenyl)ethynyl]phenoxy]butanoate.
| Compound Name | [(4E)-2-(hydroxymethyl)-4-(5-methylhexylidene)-5-oxooxolan-2-yl]methyl 4-[4-[2-(4-methylphenyl)ethynyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 154693977 |
| Molecular Formula | C32H38O6 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | [(4E)-2-(hydroxymethyl)-4-(5-methylhexylidene)-5-oxooxolan-2-yl]methyl 4-[4-[2-(4-methylphenyl)ethynyl]phenoxy]butanoate |
| SMILES | Cc1ccc(C#Cc2ccc(OCCCC(=O)OCC3(CO)C/C(=C\CCCC(C)C)C(=O)O3)cc2)cc1 |
| InChI | InChI=1S/C32H38O6/c1-24(2)7-4-5-8-28-21-32(22-33,38-31(28)35)23-37-30(34)9-6-20-36-29-18-16-27(17-19-29)15-14-26-12-10-25(3)11-13-26/h8,10-13,16-19,24,33H,4-7,9,20-23H2,1-3H3/b28-8+ |
| InChIKey | VFIWZTLOFICSSI-YLKCYHHESA-N |
| XLogP | 5.53 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|