C25H38O7S — CID 11503977
[(4Z)-2-[(4-methoxyphenoxy)methyl]-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl methanesulfonate (PubChem CID 11503977) has the molecular formula C25H38O7S and a molecular weight of 482.64 g/mol. Its IUPAC name is [(4Z)-2-[(4-methoxyphenoxy)methyl]-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl methanesulfonate.
| Compound Name | [(4Z)-2-[(4-methoxyphenoxy)methyl]-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 11503977 |
| Molecular Formula | C25H38O7S |
| Molecular Weight | 482.64 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | [(4Z)-2-[(4-methoxyphenoxy)methyl]-4-[5-methyl-3-(2-methylpropyl)hexylidene]-5-oxooxolan-2-yl]methyl methanesulfonate |
| SMILES | COc1ccc(OCC2(COS(C)(=O)=O)C/C(=C/CC(CC(C)C)CC(C)C)C(=O)O2)cc1 |
| InChI | InChI=1S/C25H38O7S/c1-18(2)13-20(14-19(3)4)7-8-21-15-25(32-24(21)26,17-31-33(6,27)28)16-30-23-11-9-22(29-5)10-12-23/h8-12,18-20H,7,13-17H2,1-6H3/b21-8- |
| InChIKey | JEHLYSOTGQRZAK-WNFQYIGGSA-N |
| XLogP | 4.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.64 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|