C31H42O3S — CID 11504183
(3E)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5,5-bis(phenylmethoxymethyl)oxolane-2-thione (PubChem CID 11504183) has the molecular formula C31H42O3S and a molecular weight of 494.74 g/mol. Its IUPAC name is (3E)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5,5-bis(phenylmethoxymethyl)oxolane-2-thione.
| Compound Name | (3E)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5,5-bis(phenylmethoxymethyl)oxolane-2-thione |
|---|---|
| PubChem CID | 11504183 |
| Molecular Formula | C31H42O3S |
| Molecular Weight | 494.74 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | (3E)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5,5-bis(phenylmethoxymethyl)oxolane-2-thione |
| SMILES | CC(C)CC(C/C=C1\CC(COCc2ccccc2)(COCc2ccccc2)OC1=S)CC(C)C |
| InChI | InChI=1S/C31H42O3S/c1-24(2)17-28(18-25(3)4)15-16-29-19-31(34-30(29)35,22-32-20-26-11-7-5-8-12-26)23-33-21-27-13-9-6-10-14-27/h5-14,16,24-25,28H,15,17-23H2,1-4H3/b29-16+ |
| InChIKey | DAHPOPZVFJSTTI-MUFRIFMGSA-N |
| XLogP | 7.93 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.74 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|