C34H32O6 — CID 11685237
(3E)-5-[(4-methoxyphenoxy)methyl]-5-(phenylmethoxymethyl)-3-[(4-phenylmethoxyphenyl)methylidene]oxolan-2-one (PubChem CID 11685237) has the molecular formula C34H32O6 and a molecular weight of 536.62 g/mol. Its IUPAC name is (3E)-5-[(4-methoxyphenoxy)methyl]-5-(phenylmethoxymethyl)-3-[(4-phenylmethoxyphenyl)methylidene]oxolan-2-one.
| Compound Name | (3E)-5-[(4-methoxyphenoxy)methyl]-5-(phenylmethoxymethyl)-3-[(4-phenylmethoxyphenyl)methylidene]oxolan-2-one |
|---|---|
| PubChem CID | 11685237 |
| Molecular Formula | C34H32O6 |
| Molecular Weight | 536.62 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | (3E)-5-[(4-methoxyphenoxy)methyl]-5-(phenylmethoxymethyl)-3-[(4-phenylmethoxyphenyl)methylidene]oxolan-2-one |
| SMILES | COc1ccc(OCC2(COCc3ccccc3)C/C(=C\c3ccc(OCc4ccccc4)cc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C34H32O6/c1-36-30-16-18-32(19-17-30)39-25-34(24-37-22-27-8-4-2-5-9-27)21-29(33(35)40-34)20-26-12-14-31(15-13-26)38-23-28-10-6-3-7-11-28/h2-20H,21-25H2,1H3/b29-20+ |
| InChIKey | HEPIHEGPCUQYEH-ZTKZIYFRSA-N |
| XLogP | 6.64 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.62 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|