C43H50O4 — CID 11250643
(3E,5R)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)-5-(trityloxymethyl)oxolan-2-one (PubChem CID 11250643) has the molecular formula C43H50O4 and a molecular weight of 630.87 g/mol. Its IUPAC name is (3E,5R)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)-5-(trityloxymethyl)oxolan-2-one.
| Compound Name | (3E,5R)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)-5-(trityloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11250643 |
| Molecular Formula | C43H50O4 |
| Molecular Weight | 630.87 g/mol |
| Exact Mass | 630.37 |
| IUPAC Name | (3E,5R)-3-[5-methyl-3-(2-methylpropyl)hexylidene]-5-(phenylmethoxymethyl)-5-(trityloxymethyl)oxolan-2-one |
| SMILES | CC(C)CC(C/C=C1\C[C@@](COCc2ccccc2)(COC(c2ccccc2)(c2ccccc2)c2ccccc2)OC1=O)CC(C)C |
| InChI | InChI=1S/C43H50O4/c1-33(2)27-36(28-34(3)4)25-26-37-29-42(47-41(37)44,31-45-30-35-17-9-5-10-18-35)32-46-43(38-19-11-6-12-20-38,39-21-13-7-14-22-39)40-23-15-8-16-24-40/h5-24,26,33-34,36H,25,27-32H2,1-4H3/b37-26+/t42-/m1/s1 |
| InChIKey | DMHAFBCWPDQHKC-NHLPPAMYSA-N |
| XLogP | 9.92 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.87 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|