C23H32O5 — CID 11646765
[(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-phenylbutanoate (PubChem CID 11646765) has the molecular formula C23H32O5 and a molecular weight of 388.50 g/mol. Its IUPAC name is [(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-phenylbutanoate.
| Compound Name | [(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-phenylbutanoate |
|---|---|
| PubChem CID | 11646765 |
| Molecular Formula | C23H32O5 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | [(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-phenylbutanoate |
| SMILES | CCCCCC/C=C1/CC(CO)(COC(=O)CCCc2ccccc2)OC1=O |
| InChI | InChI=1S/C23H32O5/c1-2-3-4-5-9-14-20-16-23(17-24,28-22(20)26)18-27-21(25)15-10-13-19-11-7-6-8-12-19/h6-8,11-12,14,24H,2-5,9-10,13,15-18H2,1H3/b20-14- |
| InChIKey | KBLCHVJEKRYHIB-ZHZULCJRSA-N |
| XLogP | 4.13 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|