C31H46O4 — CID 10743416
(2R,4E)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolane-2-carbaldehyde (PubChem CID 10743416) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is (2R,4E)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolane-2-carbaldehyde.
| Compound Name | (2R,4E)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 10743416 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | (2R,4E)-4-[(Z)-octadec-9-enylidene]-5-oxo-2-(phenylmethoxymethyl)oxolane-2-carbaldehyde |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C=C1\C[C@](C=O)(COCc2ccccc2)OC1=O |
| InChI | InChI=1S/C31H46O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-23-29-24-31(26-32,35-30(29)33)27-34-25-28-21-18-17-19-22-28/h9-10,17-19,21-23,26H,2-8,11-16,20,24-25,27H2,1H3/b10-9-,29-23+/t31-/m0/s1 |
| InChIKey | PGXRWDWNCQHJJX-DIMDBJLFSA-N |
| XLogP | 8.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|