C21H28O5 — CID 44562097
[(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-methylbenzoate (PubChem CID 44562097) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-methylbenzoate.
| Compound Name | [(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-methylbenzoate |
|---|---|
| PubChem CID | 44562097 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(4Z)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 2-methylbenzoate |
| SMILES | CCCCCC/C=C1/CC(CO)(COC(=O)c2ccccc2C)OC1=O |
| InChI | InChI=1S/C21H28O5/c1-3-4-5-6-7-11-17-13-21(14-22,26-19(17)23)15-25-20(24)18-12-9-8-10-16(18)2/h8-12,22H,3-7,13-15H2,1-2H3/b17-11- |
| InChIKey | KHWLSWOFWKMXML-BOPFTXTBSA-N |
| XLogP | 3.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|