C20H32O5 — CID 25052844
[(4E)-4-(cyclohexylmethylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl heptanoate (PubChem CID 25052844) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is [(4E)-4-(cyclohexylmethylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl heptanoate.
| Compound Name | [(4E)-4-(cyclohexylmethylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl heptanoate |
|---|---|
| PubChem CID | 25052844 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | [(4E)-4-(cyclohexylmethylidene)-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl heptanoate |
| SMILES | CCCCCCC(=O)OCC1(CO)C/C(=C\C2CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C20H32O5/c1-2-3-4-8-11-18(22)24-15-20(14-21)13-17(19(23)25-20)12-16-9-6-5-7-10-16/h12,16,21H,2-11,13-15H2,1H3/b17-12+ |
| InChIKey | YOHGGNOICHXJBN-SFQUDFHCSA-N |
| XLogP | 3.68 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|