C21H25F3O5 — CID 25053332
[(4E)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-(trifluoromethyl)benzoate (PubChem CID 25053332) has the molecular formula C21H25F3O5 and a molecular weight of 414.42 g/mol. Its IUPAC name is [(4E)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-(trifluoromethyl)benzoate.
| Compound Name | [(4E)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 25053332 |
| Molecular Formula | C21H25F3O5 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(4E)-4-heptylidene-2-(hydroxymethyl)-5-oxooxolan-2-yl]methyl 4-(trifluoromethyl)benzoate |
| SMILES | CCCCCC/C=C1\CC(CO)(COC(=O)c2ccc(C(F)(F)F)cc2)OC1=O |
| InChI | InChI=1S/C21H25F3O5/c1-2-3-4-5-6-7-16-12-20(13-25,29-19(16)27)14-28-18(26)15-8-10-17(11-9-15)21(22,23)24/h7-11,25H,2-6,12-14H2,1H3/b16-7+ |
| InChIKey | AUFRJRJMEKJNIC-FRKPEAEDSA-N |
| XLogP | 4.44 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|