C16H20O4 — CID 162891457
(1R,5R,6S,8R,15R)-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-ene-3,10-dione (PubChem CID 162891457) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is (1R,5R,6S,8R,15R)-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-ene-3,10-dione.
| Compound Name | (1R,5R,6S,8R,15R)-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-ene-3,10-dione |
|---|---|
| PubChem CID | 162891457 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (1R,5R,6S,8R,15R)-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-ene-3,10-dione |
| SMILES | C[C@H]1C[C@H]2OC(=O)C3=CCC[C@]4(OC(=O)C[C@]14C)[C@]32C |
| InChI | InChI=1S/C16H20O4/c1-9-7-11-15(3)10(13(18)19-11)5-4-6-16(15)14(9,2)8-12(17)20-16/h5,9,11H,4,6-8H2,1-3H3/t9-,11+,14+,15+,16+/m0/s1 |
| InChIKey | AQZDDSPBDJXPNE-PEIKOTFYSA-N |
| XLogP | 2.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |