C21H26O7 — CID 162913094
3-(2-hydroxy-5-oxo-2H-furan-3-yl)-3-methoxy-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one (PubChem CID 162913094) has the molecular formula C21H26O7 and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-(2-hydroxy-5-oxo-2H-furan-3-yl)-3-methoxy-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one.
| Compound Name | 3-(2-hydroxy-5-oxo-2H-furan-3-yl)-3-methoxy-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one |
|---|---|
| PubChem CID | 162913094 |
| Molecular Formula | C21H26O7 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 3-(2-hydroxy-5-oxo-2H-furan-3-yl)-3-methoxy-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one |
| SMILES | COC1(C2=CC(=O)OC2O)CC2(C)C(C)CC3OC(=O)C4=CCCC2(O1)C43C |
| InChI | InChI=1S/C21H26O7/c1-11-8-14-19(3)12(16(23)26-14)6-5-7-21(19)18(11,2)10-20(25-4,28-21)13-9-15(22)27-17(13)24/h6,9,11,14,17,24H,5,7-8,10H2,1-4H3 |
| InChIKey | BRICYYVBYCCOCH-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |