C22H28O7 — CID 162996910
(1R,3S,5R,6S,8R,15R)-3-ethoxy-3-[(2R)-2-hydroxy-5-oxo-2H-furan-3-yl]-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one (PubChem CID 162996910) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is (1R,3S,5R,6S,8R,15R)-3-ethoxy-3-[(2R)-2-hydroxy-5-oxo-2H-furan-3-yl]-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one.
| Compound Name | (1R,3S,5R,6S,8R,15R)-3-ethoxy-3-[(2R)-2-hydroxy-5-oxo-2H-furan-3-yl]-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one |
|---|---|
| PubChem CID | 162996910 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (1R,3S,5R,6S,8R,15R)-3-ethoxy-3-[(2R)-2-hydroxy-5-oxo-2H-furan-3-yl]-5,6,15-trimethyl-2,9-dioxatetracyclo[6.6.1.01,5.011,15]pentadec-11-en-10-one |
| SMILES | CCO[C@@]1(C2=CC(=O)O[C@H]2O)C[C@]2(C)[C@@H](C)C[C@H]3OC(=O)C4=CCC[C@]2(O1)[C@]43C |
| InChI | InChI=1S/C22H28O7/c1-5-26-21(14-10-16(23)28-18(14)25)11-19(3)12(2)9-15-20(4)13(17(24)27-15)7-6-8-22(19,20)29-21/h7,10,12,15,18,25H,5-6,8-9,11H2,1-4H3/t12-,15+,18+,19+,20+,21-,22+/m0/s1 |
| InChIKey | TXZDIEFWSLOYAP-ZJQYTSROSA-N |
| XLogP | 2.38 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |