C17H26O5 — CID 101166491
ethyl (1R,6S,7R,9R,10S)-7-hydroxy-10-(hydroxymethyl)-6,10-dimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-2-carboxylate (PubChem CID 101166491) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl (1R,6S,7R,9R,10S)-7-hydroxy-10-(hydroxymethyl)-6,10-dimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-2-carboxylate.
| Compound Name | ethyl (1R,6S,7R,9R,10S)-7-hydroxy-10-(hydroxymethyl)-6,10-dimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 101166491 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | ethyl (1R,6S,7R,9R,10S)-7-hydroxy-10-(hydroxymethyl)-6,10-dimethyl-11-oxatricyclo[7.2.1.01,6]dodec-2-ene-2-carboxylate |
| SMILES | CCOC(=O)C1=CCC[C@@]2(C)[C@H](O)C[C@@H]3C[C@]12O[C@]3(C)CO |
| InChI | InChI=1S/C17H26O5/c1-4-21-14(20)12-6-5-7-15(2)13(19)8-11-9-17(12,15)22-16(11,3)10-18/h6,11,13,18-19H,4-5,7-10H2,1-3H3/t11-,13-,15+,16-,17+/m1/s1 |
| InChIKey | BVKIVTZGAWXBJZ-YRXRADQDSA-N |
| XLogP | 1.57 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |