C14H22ClNO3 — CID 139215251
ethyl 5-tert-butylimino-2-(1-chloroethyl)-2-methylfuran-3-carboxylate (PubChem CID 139215251) has the molecular formula C14H22ClNO3 and a molecular weight of 287.79 g/mol. Its IUPAC name is ethyl 5-tert-butylimino-2-(1-chloroethyl)-2-methylfuran-3-carboxylate.
| Compound Name | ethyl 5-tert-butylimino-2-(1-chloroethyl)-2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 139215251 |
| Molecular Formula | C14H22ClNO3 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | ethyl 5-tert-butylimino-2-(1-chloroethyl)-2-methylfuran-3-carboxylate |
| SMILES | CCOC(=O)C1=C/C(=N\C(C)(C)C)OC1(C)C(C)Cl |
| InChI | InChI=1S/C14H22ClNO3/c1-7-18-12(17)10-8-11(16-13(3,4)5)19-14(10,6)9(2)15/h8-9H,7H2,1-6H3/b16-11+ |
| InChIKey | PDBHCOWUBITWKP-LFIBNONCSA-N |
| XLogP | 3.09 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|