C46H52O18 — CID 18943071
ethyl 4-[bis(8-ethoxycarbonyl-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carboxylate (PubChem CID 18943071) has the molecular formula C46H52O18 and a molecular weight of 892.90 g/mol. Its IUPAC name is ethyl 4-[bis(8-ethoxycarbonyl-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carboxylate.
| Compound Name | ethyl 4-[bis(8-ethoxycarbonyl-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carboxylate |
|---|---|
| PubChem CID | 18943071 |
| Molecular Formula | C46H52O18 |
| Molecular Weight | 892.90 g/mol |
| Exact Mass | 892.32 |
| IUPAC Name | ethyl 4-[bis(8-ethoxycarbonyl-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxol-4-yl)methyl]-2,2,6,6-tetramethyl-[1,3]dioxolo[4,5-f][1,3]benzodioxole-8-carboxylate |
| SMILES | CCOC(=O)c1c2c(c(C(c3c4c(c(C(=O)OCC)c5c3OC(C)(C)O5)OC(C)(C)O4)c3c4c(c(C(=O)OCC)c5c3OC(C)(C)O5)OC(C)(C)O4)c3c1OC(C)(C)O3)OC(C)(C)O2 |
| InChI | InChI=1S/C46H52O18/c1-16-50-38(47)23-32-26(53-41(4,5)59-32)20(27-33(23)60-42(6,7)54-27)19(21-28-34(61-43(8,9)55-28)24(39(48)51-17-2)35-29(21)56-44(10,11)62-35)22-30-36(63-45(12,13)57-30)25(40(49)52-18-3)37-31(22)58-46(14,15)64-37/h19H,16-18H2,1-15H3 |
| InChIKey | SPPSBCCTAXOJAH-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 189.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.90 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|