C21H26ClNO5 — CID 102054410
diethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3,4-dicarboxylate (PubChem CID 102054410) has the molecular formula C21H26ClNO5 and a molecular weight of 407.89 g/mol. Its IUPAC name is diethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3,4-dicarboxylate.
| Compound Name | diethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 102054410 |
| Molecular Formula | C21H26ClNO5 |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | diethyl 5-tert-butylimino-2-(chloromethyl)-2-phenylfuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(CCl)(c2ccccc2)O/C1=N\C(C)(C)C |
| InChI | InChI=1S/C21H26ClNO5/c1-6-26-18(24)15-16(19(25)27-7-2)21(13-22,14-11-9-8-10-12-14)28-17(15)23-20(3,4)5/h8-12H,6-7,13H2,1-5H3/b23-17- |
| InChIKey | HQTIJHOHZWIFID-QJOMJCCJSA-N |
| XLogP | 3.77 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|