C17H16BrClO6 — CID 53309952
diethyl 2-(bromomethyl)-2-(4-chlorophenyl)-5-oxofuran-3,4-dicarboxylate (PubChem CID 53309952) has the molecular formula C17H16BrClO6 and a molecular weight of 431.67 g/mol. Its IUPAC name is diethyl 2-(bromomethyl)-2-(4-chlorophenyl)-5-oxofuran-3,4-dicarboxylate.
| Compound Name | diethyl 2-(bromomethyl)-2-(4-chlorophenyl)-5-oxofuran-3,4-dicarboxylate |
|---|---|
| PubChem CID | 53309952 |
| Molecular Formula | C17H16BrClO6 |
| Molecular Weight | 431.67 g/mol |
| Exact Mass | 429.98 |
| IUPAC Name | diethyl 2-(bromomethyl)-2-(4-chlorophenyl)-5-oxofuran-3,4-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C(=O)OCC)C(CBr)(c2ccc(Cl)cc2)OC1=O |
| InChI | InChI=1S/C17H16BrClO6/c1-3-23-14(20)12-13(16(22)24-4-2)17(9-18,25-15(12)21)10-5-7-11(19)8-6-10/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | SMOZQNZTWNBXSE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.67 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|