About ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate
ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate (PubChem CID 115586997) has the molecular formula C15H20N2O3
and a molecular weight of 276.34 g/mol. Its IUPAC name is ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate |
| PubChem CID | 115586997 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate |
| SMILES | CCOC(=O)c1nnc(C23CC4CC(CC(C4)C2)C3)o1 |
| InChI | InChI=1S/C15H20N2O3/c1-2-19-13(18)12-16-17-14(20-12)15-6-9-3-10(7-15)5-11(4-9)8-15/h9-11H,2-8H2,1H3 |
| InChIKey | GPNDOTGSAGLQGV-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate?
The IUPAC name of ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate (CID 115586997) is ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate.
What is the SMILES notation for ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate?
The canonical SMILES for ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate is CCOC(=O)c1nnc(C23CC4CC(CC(C4)C2)C3)o1.
What is the InChIKey of ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate?
The InChIKey is GPNDOTGSAGLQGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O3/c1-2-19-13(18)12-16-17-14(20-12)15-6-9-3-10(7-15)5-11(4-9)8-15/h9-11H,2-8H2,1H3.
What are the key properties of ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate?
ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate has a molecular weight of 276.34 g/mol, XLogP of 2.71, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(1-adamantyl)-1,3,4-oxadiazole-2-carboxylate is sourced from PubChem (CID 115586997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).