C21H34N3O5P — CID 102417879
ethyl 3-[1-(1-adamantyl)triazol-4-yl]-2-diethoxyphosphorylpropanoate (PubChem CID 102417879) has the molecular formula C21H34N3O5P and a molecular weight of 439.49 g/mol. Its IUPAC name is ethyl 3-[1-(1-adamantyl)triazol-4-yl]-2-diethoxyphosphorylpropanoate.
| Compound Name | ethyl 3-[1-(1-adamantyl)triazol-4-yl]-2-diethoxyphosphorylpropanoate |
|---|---|
| PubChem CID | 102417879 |
| Molecular Formula | C21H34N3O5P |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.22 |
| IUPAC Name | ethyl 3-[1-(1-adamantyl)triazol-4-yl]-2-diethoxyphosphorylpropanoate |
| SMILES | CCOC(=O)C(Cc1cn(C23CC4CC(CC(C4)C2)C3)nn1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C21H34N3O5P/c1-4-27-20(25)19(30(26,28-5-2)29-6-3)10-18-14-24(23-22-18)21-11-15-7-16(12-21)9-17(8-15)13-21/h14-17,19H,4-13H2,1-3H3 |
| InChIKey | RMSMRIYSKIJUCQ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 92.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|