C32H56N6O12P4 — CID 16753933
4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[[3-[[4-[2,2-bis(diethoxyphosphoryl)ethyl]triazol-1-yl]methyl]phenyl]methyl]triazole (PubChem CID 16753933) has the molecular formula C32H56N6O12P4 and a molecular weight of 840.73 g/mol. Its IUPAC name is 4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[[3-[[4-[2,2-bis(diethoxyphosphoryl)ethyl]triazol-1-yl]methyl]phenyl]methyl]triazole.
| Compound Name | 4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[[3-[[4-[2,2-bis(diethoxyphosphoryl)ethyl]triazol-1-yl]methyl]phenyl]methyl]triazole |
|---|---|
| PubChem CID | 16753933 |
| Molecular Formula | C32H56N6O12P4 |
| Molecular Weight | 840.73 g/mol |
| Exact Mass | 840.29 |
| IUPAC Name | 4-[2,2-bis(diethoxyphosphoryl)ethyl]-1-[[3-[[4-[2,2-bis(diethoxyphosphoryl)ethyl]triazol-1-yl]methyl]phenyl]methyl]triazole |
| SMILES | CCOP(=O)(OCC)C(Cc1cn(Cc2cccc(Cn3cc(CC(P(=O)(OCC)OCC)P(=O)(OCC)OCC)nn3)c2)nn1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C32H56N6O12P4/c1-9-43-51(39,44-10-2)31(52(40,45-11-3)46-12-4)21-29-25-37(35-33-29)23-27-18-17-19-28(20-27)24-38-26-30(34-36-38)22-32(53(41,47-13-5)48-14-6)54(42,49-15-7)50-16-8/h17-20,25-26,31-32H,9-16,21-24H2,1-8H3 |
| InChIKey | BYSYOJSQDZNACA-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 203.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.73 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|