C16H15N3O3 — CID 166366791
3-[[4-[(3-hydroxyphenoxy)methyl]triazol-1-yl]methyl]phenol (PubChem CID 166366791) has the molecular formula C16H15N3O3 and a molecular weight of 297.31 g/mol. Its IUPAC name is 3-[[4-[(3-hydroxyphenoxy)methyl]triazol-1-yl]methyl]phenol.
| Compound Name | 3-[[4-[(3-hydroxyphenoxy)methyl]triazol-1-yl]methyl]phenol |
|---|---|
| PubChem CID | 166366791 |
| Molecular Formula | C16H15N3O3 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 3-[[4-[(3-hydroxyphenoxy)methyl]triazol-1-yl]methyl]phenol |
| SMILES | Oc1cccc(Cn2cc(COc3cccc(O)c3)nn2)c1 |
| InChI | InChI=1S/C16H15N3O3/c20-14-4-1-3-12(7-14)9-19-10-13(17-18-19)11-22-16-6-2-5-15(21)8-16/h1-8,10,20-21H,9,11H2 |
| InChIKey | DAABEOMZEHLGJM-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 80.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |