C16H14IN3O — CID 169095528
1-[(4-iodophenyl)methyl]-4-(phenoxymethyl)triazole (PubChem CID 169095528) has the molecular formula C16H14IN3O and a molecular weight of 391.21 g/mol. Its IUPAC name is 1-[(4-iodophenyl)methyl]-4-(phenoxymethyl)triazole.
| Compound Name | 1-[(4-iodophenyl)methyl]-4-(phenoxymethyl)triazole |
|---|---|
| PubChem CID | 169095528 |
| Molecular Formula | C16H14IN3O |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | 1-[(4-iodophenyl)methyl]-4-(phenoxymethyl)triazole |
| SMILES | Ic1ccc(Cn2cc(COc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C16H14IN3O/c17-14-8-6-13(7-9-14)10-20-11-15(18-19-20)12-21-16-4-2-1-3-5-16/h1-9,11H,10,12H2 |
| InChIKey | KHGWJVZHYYBYBA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|