C25H20FN3O2 — CID 85468959
(E)-1-[4-[[1-[(4-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]-3-phenylprop-2-en-1-one (PubChem CID 85468959) has the molecular formula C25H20FN3O2 and a molecular weight of 413.45 g/mol. Its IUPAC name is (E)-1-[4-[[1-[(4-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-[[1-[(4-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 85468959 |
| Molecular Formula | C25H20FN3O2 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (E)-1-[4-[[1-[(4-fluorophenyl)methyl]triazol-4-yl]methoxy]phenyl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)c1ccc(OCc2cn(Cc3ccc(F)cc3)nn2)cc1 |
| InChI | InChI=1S/C25H20FN3O2/c26-22-11-6-20(7-12-22)16-29-17-23(27-28-29)18-31-24-13-9-21(10-14-24)25(30)15-8-19-4-2-1-3-5-19/h1-15,17H,16,18H2/b15-8+ |
| InChIKey | RVNIKXMVUQQSSL-OVCLIPMQSA-N |
| XLogP | 4.94 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|