C22H20F3N3O3 — CID 155546521
3-[1-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate (PubChem CID 155546521) has the molecular formula C22H20F3N3O3 and a molecular weight of 431.41 g/mol. Its IUPAC name is 3-[1-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate.
| Compound Name | 3-[1-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 155546521 |
| Molecular Formula | C22H20F3N3O3 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[1-[[4-(trifluoromethoxy)phenyl]methyl]triazol-4-yl]propyl (E)-3-phenylprop-2-enoate |
| SMILES | O=C(/C=C/c1ccccc1)OCCCc1cn(Cc2ccc(OC(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C22H20F3N3O3/c23-22(24,25)31-20-11-8-18(9-12-20)15-28-16-19(26-27-28)7-4-14-30-21(29)13-10-17-5-2-1-3-6-17/h1-3,5-6,8-13,16H,4,7,14-15H2/b13-10+ |
| InChIKey | NBYLHRXHDLGHME-JLHYYAGUSA-N |
| XLogP | 4.41 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|