C19H17F3N4O2 — CID 134003826
1-benzyl-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide (PubChem CID 134003826) has the molecular formula C19H17F3N4O2 and a molecular weight of 390.37 g/mol. Its IUPAC name is 1-benzyl-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 134003826 |
| Molecular Formula | C19H17F3N4O2 |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 1-benzyl-N-methyl-N-[[4-(trifluoromethoxy)phenyl]methyl]triazole-4-carboxamide |
| SMILES | CN(Cc1ccc(OC(F)(F)F)cc1)C(=O)c1cn(Cc2ccccc2)nn1 |
| InChI | InChI=1S/C19H17F3N4O2/c1-25(11-15-7-9-16(10-8-15)28-19(20,21)22)18(27)17-13-26(24-23-17)12-14-5-3-2-4-6-14/h2-10,13H,11-12H2,1H3 |
| InChIKey | BOEYWEKIXGMMNW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |