C20H22N4O3 — CID 25368105
N-benzyl-N-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide (PubChem CID 25368105) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 25368105 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide |
| SMILES | COc1ccc(Cn2cc(C(=O)N(CCO)Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C20H22N4O3/c1-27-18-9-7-17(8-10-18)14-24-15-19(21-22-24)20(26)23(11-12-25)13-16-5-3-2-4-6-16/h2-10,15,25H,11-14H2,1H3 |
| InChIKey | IEUASFWFCBLCDE-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |