C20H19F3N4O2 — CID 25457991
N-benzyl-N-(2-hydroxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide (PubChem CID 25457991) has the molecular formula C20H19F3N4O2 and a molecular weight of 404.39 g/mol. Its IUPAC name is N-benzyl-N-(2-hydroxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | N-benzyl-N-(2-hydroxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 25457991 |
| Molecular Formula | C20H19F3N4O2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-benzyl-N-(2-hydroxyethyl)-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide |
| SMILES | O=C(c1cn(Cc2ccccc2C(F)(F)F)nn1)N(CCO)Cc1ccccc1 |
| InChI | InChI=1S/C20H19F3N4O2/c21-20(22,23)17-9-5-4-8-16(17)13-27-14-18(24-25-27)19(29)26(10-11-28)12-15-6-2-1-3-7-15/h1-9,14,28H,10-13H2 |
| InChIKey | XZKKVOFUEGFUOW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |