C20H21F3N4O — CID 25446260
N-cyclohexyl-N-prop-2-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide (PubChem CID 25446260) has the molecular formula C20H21F3N4O and a molecular weight of 390.41 g/mol. Its IUPAC name is N-cyclohexyl-N-prop-2-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | N-cyclohexyl-N-prop-2-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 25446260 |
| Molecular Formula | C20H21F3N4O |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | N-cyclohexyl-N-prop-2-ynyl-1-[[2-(trifluoromethyl)phenyl]methyl]triazole-4-carboxamide |
| SMILES | C#CCN(C(=O)c1cn(Cc2ccccc2C(F)(F)F)nn1)C1CCCCC1 |
| InChI | InChI=1S/C20H21F3N4O/c1-2-12-27(16-9-4-3-5-10-16)19(28)18-14-26(25-24-18)13-15-8-6-7-11-17(15)20(21,22)23/h1,6-8,11,14,16H,3-5,9-10,12-13H2 |
| InChIKey | IWIZYGDJJIKCLU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|