C17H17ClN4O2 — CID 56905401
1-[(4-chlorophenyl)methyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide (PubChem CID 56905401) has the molecular formula C17H17ClN4O2 and a molecular weight of 344.80 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 56905401 |
| Molecular Formula | C17H17ClN4O2 |
| Molecular Weight | 344.80 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide |
| SMILES | Cc1ccc(CN(C)C(=O)c2cn(Cc3ccc(Cl)cc3)nn2)o1 |
| InChI | InChI=1S/C17H17ClN4O2/c1-12-3-8-15(24-12)10-21(2)17(23)16-11-22(20-19-16)9-13-4-6-14(18)7-5-13/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | RMYXXPWGOHBXQA-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 64.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.80 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |