C16H24N4O4 — CID 51101279
1-(2,2-diethoxyethyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide (PubChem CID 51101279) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide.
| Compound Name | 1-(2,2-diethoxyethyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 51101279 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-N-methyl-N-[(5-methylfuran-2-yl)methyl]triazole-4-carboxamide |
| SMILES | CCOC(Cn1cc(C(=O)N(C)Cc2ccc(C)o2)nn1)OCC |
| InChI | InChI=1S/C16H24N4O4/c1-5-22-15(23-6-2)11-20-10-14(17-18-20)16(21)19(4)9-13-8-7-12(3)24-13/h7-8,10,15H,5-6,9,11H2,1-4H3 |
| InChIKey | UCZSWJSBWTUWRS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 82.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|