C18H25N5O4S — CID 56544141
S-[4-[[1-(2,2-diethoxyethyl)triazole-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate (PubChem CID 56544141) has the molecular formula C18H25N5O4S and a molecular weight of 407.50 g/mol. Its IUPAC name is S-[4-[[1-(2,2-diethoxyethyl)triazole-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate.
| Compound Name | S-[4-[[1-(2,2-diethoxyethyl)triazole-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 56544141 |
| Molecular Formula | C18H25N5O4S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | S-[4-[[1-(2,2-diethoxyethyl)triazole-4-carbonyl]amino]phenyl] N,N-dimethylcarbamothioate |
| SMILES | CCOC(Cn1cc(C(=O)Nc2ccc(SC(=O)N(C)C)cc2)nn1)OCC |
| InChI | InChI=1S/C18H25N5O4S/c1-5-26-16(27-6-2)12-23-11-15(20-21-23)17(24)19-13-7-9-14(10-8-13)28-18(25)22(3)4/h7-11,16H,5-6,12H2,1-4H3,(H,19,24) |
| InChIKey | RANWNPPBFPSZEY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|