C19H32N6O3S — CID 51129702
1-(2,2-diethoxyethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide (PubChem CID 51129702) has the molecular formula C19H32N6O3S and a molecular weight of 424.57 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide.
| Compound Name | 1-(2,2-diethoxyethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 51129702 |
| Molecular Formula | C19H32N6O3S |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-N-(5-octyl-1,3,4-thiadiazol-2-yl)triazole-4-carboxamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2cn(CC(OCC)OCC)nn2)s1 |
| InChI | InChI=1S/C19H32N6O3S/c1-4-7-8-9-10-11-12-16-22-23-19(29-16)20-18(26)15-13-25(24-21-15)14-17(27-5-2)28-6-3/h13,17H,4-12,14H2,1-3H3,(H,20,23,26) |
| InChIKey | VGZTYRVOKGEQCD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 104.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|