C15H21N3OS2 — CID 60567181
N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-propan-2-ylthiophene-2-carboxamide (PubChem CID 60567181) has the molecular formula C15H21N3OS2 and a molecular weight of 323.49 g/mol. Its IUPAC name is N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-propan-2-ylthiophene-2-carboxamide.
| Compound Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-propan-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 60567181 |
| Molecular Formula | C15H21N3OS2 |
| Molecular Weight | 323.49 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | N-(5-pentyl-1,3,4-thiadiazol-2-yl)-3-propan-2-ylthiophene-2-carboxamide |
| SMILES | CCCCCc1nnc(NC(=O)c2sccc2C(C)C)s1 |
| InChI | InChI=1S/C15H21N3OS2/c1-4-5-6-7-12-17-18-15(21-12)16-14(19)13-11(10(2)3)8-9-20-13/h8-10H,4-7H2,1-3H3,(H,16,18,19) |
| InChIKey | XGODISBNRXUUMJ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|